![[ICO]](/icons/blank.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - Bi Vafa.mp3 | 2019-10-15 18:28 | 3.5M | |
| 01 - Cancel.mp3 | 2019-10-15 18:28 | 3.3M | |
| 01 - Ino Zadam Ta Be..> | 2019-10-15 18:28 | 3.9M | |
| 01 - Midoonam Barnem..> | 2019-10-15 18:28 | 3.6M | |
| 01 - Paiez.mp3 | 2019-10-15 18:28 | 3.8M | |
| 01. Daram Miram [128..> | 2019-10-15 18:28 | 3.2M | |
| 01 To Ghosse Nakhor.mp3 | 2019-10-15 18:28 | 3.2M | |
| 02 - Avare.mp3 | 2019-10-15 18:28 | 4.7M | |
| 02 - Nefrin.mp3 | 2019-10-15 18:28 | 3.2M | |
| 02 - Nemidooni Nemit..> | 2019-10-15 18:28 | 3.9M | |
| 02 - Noghte Chin.mp3 | 2019-10-15 18:28 | 2.9M | |
| 02 - Rooze Jodaie.mp3 | 2019-10-15 18:28 | 2.9M | |
| 02. Bebakhsh [128].mp3 | 2019-10-15 18:28 | 5.3M | |
| 02 Belataklif.mp3 | 2019-10-15 18:28 | 4.3M | |
| 03 - Bi Neshoon.mp3 | 2019-10-15 18:28 | 2.7M | |
| 03 - Dige Majboor Ni..> | 2019-10-15 18:28 | 4.6M | |
| 03 - Khodais.mp3 | 2019-10-15 18:28 | 4.4M | |
| 03 - Movazebe Khodet..> | 2019-10-15 18:28 | 3.6M | |
| 03 - Yeki Bood Yeki ..> | 2019-10-15 18:28 | 3.0M | |
| 03. Delshekaste [128..> | 2019-10-15 18:28 | 3.4M | |
| 03 Dar o Nadar.mp3 | 2019-10-15 18:28 | 3.1M | |
| 04 - Deltangi.mp3 | 2019-10-15 18:28 | 3.0M | |
| 04 - Ghesmat Nabood.mp3 | 2019-10-15 18:28 | 3.4M | |
| 04 - Khodahafez Gole..> | 2019-10-15 18:28 | 2.7M | |
| 04 - Lahzeye Akhar.mp3 | 2019-10-15 18:28 | 4.1M | |
| 04 - Mosafer.mp3 | 2019-10-15 18:28 | 4.4M | |
| 04. Lajbazi [128].mp3 | 2019-10-15 18:28 | 4.0M | |
| 04 Dige Miram.mp3 | 2019-10-15 18:28 | 5.3M | |
| 05 - Farda.mp3 | 2019-10-15 18:28 | 4.7M | |
| 05 - Hamkhoone.mp3 | 2019-10-15 18:28 | 3.5M | |
| 05 - Tak Setareh.mp3 | 2019-10-15 18:28 | 3.5M | |
| 05 - To Dige Daghoon..> | 2019-10-15 18:28 | 2.7M | |
| 05 - Zakhme Zaboon.mp3 | 2019-10-15 18:28 | 4.2M | |
| 05. Adat [128].mp3 | 2019-10-15 18:28 | 4.8M | |
| 05 Halgheh.mp3 | 2019-10-15 18:28 | 6.2M | |
| 06 - Begi Nagi.mp3 | 2019-10-15 18:28 | 3.1M | |
| 06 - Che Margame.mp3 | 2019-10-15 18:28 | 3.5M | |
| 06 - Darya.mp3 | 2019-10-15 18:28 | 5.2M | |
| 06 - Khakam Nakonid.mp3 | 2019-10-15 18:28 | 2.6M | |
| 06 - Tanhatarin Tanh..> | 2019-10-15 18:28 | 3.4M | |
| 06. Baroon [128].mp3 | 2019-10-15 18:28 | 5.4M | |
| 06 Taghieer Kardi.mp3 | 2019-10-15 18:28 | 4.4M | |
| 07 - Ghalbe To Darya..> | 2019-10-15 18:28 | 3.5M | |
| 07 - Gharare Tanhaie..> | 2019-10-15 18:28 | 3.7M | |
| 07 - Khoda Kari Boko..> | 2019-10-15 18:28 | 3.3M | |
| 07 - Prances.mp3 | 2019-10-15 18:28 | 2.3M | |
| 07 - Tasliat Ghalbe ..> | 2019-10-15 18:28 | 1.3M | |
| 07. Bachegi [128].mp3 | 2019-10-15 18:28 | 6.0M | |
| 07 Negaran.mp3 | 2019-10-15 18:28 | 4.7M | |
| 08 - Ba Ki Sohbat Mi..> | 2019-10-15 18:28 | 3.6M | |
| 08 - Vaghti Ke Delet..> | 2019-10-15 18:28 | 3.5M | |
| 08. Madar [128].mp3 | 2019-10-15 18:28 | 5.6M | |
| 08 Bahooneh.mp3 | 2019-10-15 18:28 | 3.0M | |
| 09 - Nemizaram Ke Ba..> | 2019-10-15 18:28 | 4.3M | |
| 09 - Too Asheghi Pic..> | 2019-10-15 18:28 | 2.0M | |
| 09. Narahat [128].mp3 | 2019-10-15 18:28 | 3.7M | |
| 09 Man o Bebakhsh.mp3 | 2019-10-15 18:28 | 4.5M | |
| 10 - Not.mp3 | 2019-10-15 18:28 | 2.3M | |
| 10 To Avaz Shodi.mp3 | 2019-10-15 18:28 | 5.7M | |
| 12 To Azadi.mp3 | 2019-10-15 18:28 | 4.4M | |
| 13 Eshtebah Kardam.mp3 | 2019-10-15 18:28 | 4.0M | |
| 14 Khoda Negahdar.mp3 | 2019-10-15 18:28 | 3.3M | |
| Majid Kharatha - 01 ..> | 2019-10-15 18:28 | 5.8M | |
| Majid Kharatha - 02 ..> | 2019-10-15 18:28 | 4.4M | |
| Majid Kharatha - 03 ..> | 2019-10-15 18:28 | 6.1M | |
| Majid Kharatha - 04 ..> | 2019-10-15 18:28 | 3.0M | |
| Majid Kharatha - 05 ..> | 2019-10-15 18:28 | 4.4M | |
| Majid Kharatha - 06 ..> | 2019-10-15 18:28 | 4.4M | |
| Majid Kharatha - 07 ..> | 2019-10-15 18:28 | 4.8M | |